* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 5640699 |
| English Synonyms: | EMOLECULES 5640699 |
| MDL Number.: | MFCD02960659 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1nc(c2c3c(sc2n1)CCCC3)NCC(=O)O.Cl |
| InChi: | InChI=1S/C12H13N3O2S.ClH/c16-9(17)5-13-11-10-7-3-1-2-4-8(7)18-12(10)15-6-14-11;/h6H,1-5H2,(H,16,17)(H,13,14,15);1H |
| InChiKey: | InChIKey=SNOHSQVBELYCAZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.