* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | EMOLECULES 1872666 |
English Synonyms: | EMOLECULES 1872666 |
MDL Number.: | MFCD02969014 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | CCOC(=O)c1cnc2ccc(cc2c1NCCCC(=O)O)OC |
InChi: | InChI=1S/C17H20N2O5/c1-3-24-17(22)13-10-19-14-7-6-11(23-2)9-12(14)16(13)18-8-4-5-15(20)21/h6-7,9-10H,3-5,8H2,1-2H3,(H,18,19)(H,20,21) |
InChiKey: | InChIKey=QACNZQFZCWQHSU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.