* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 1869493 |
| English Synonyms: | EMOLECULES 1869493 |
| MDL Number.: | MFCD02977576 |
| H bond acceptor: | 8 |
| H bond donor: | 4 |
| Smile: | Cc1c(nc(=O)[nH]n1)NNc2ccc(cc2)C(=O)O |
| InChi: | InChI=1S/C11H11N5O3/c1-6-9(12-11(19)16-13-6)15-14-8-4-2-7(3-5-8)10(17)18/h2-5,14H,1H3,(H,17,18)(H2,12,15,16,19) |
| InChiKey: | InChIKey=OSXKENNRANHDPI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.