* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 4432897 |
| English Synonyms: | EMOLECULES 4432897 |
| MDL Number.: | MFCD02987171 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CC1CC2(CCCC2)Nc3c1cc(cc3)F |
| InChi: | InChI=1S/C14H18FN/c1-10-9-14(6-2-3-7-14)16-13-5-4-11(15)8-12(10)13/h4-5,8,10,16H,2-3,6-7,9H2,1H3 |
| InChiKey: | InChIKey=IFQKGVHXRFEMTP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.