* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 1876504 |
| English Synonyms: | EMOLECULES 1876504 |
| MDL Number.: | MFCD03000664 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CC(C)CC(C(=O)O)Nc1c2cc(ccc2ncn1)Br |
| InChi: | InChI=1S/C14H16BrN3O2/c1-8(2)5-12(14(19)20)18-13-10-6-9(15)3-4-11(10)16-7-17-13/h3-4,6-8,12H,5H2,1-2H3,(H,19,20)(H,16,17,18) |
| InChiKey: | InChIKey=CGVJSCOXEHOOCG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.