* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 26302783 |
| English Synonyms: | EMOLECULES 26302783 |
| MDL Number.: | MFCD03011704 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1ccnc(c1)C\2CCCC/C2=N/O |
| InChi: | InChI=1S/C11H14N2O/c14-13-11-7-2-1-5-9(11)10-6-3-4-8-12-10/h3-4,6,8-9,14H,1-2,5,7H2/b13-11- |
| InChiKey: | InChIKey=GVMAYKQRHPICEB-QBFSEMIESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.