* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 27680103 |
| English Synonyms: | EMOLECULES 27680103 |
| MDL Number.: | MFCD03038539 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | c1cc(cc(c1)[N+](=O)[O-])N[C@H]2CS(=O)(=O)C[C@H]2O |
| InChi: | InChI=1S/C10H12N2O5S/c13-10-6-18(16,17)5-9(10)11-7-2-1-3-8(4-7)12(14)15/h1-4,9-11,13H,5-6H2/t9-,10+/m0/s1 |
| InChiKey: | InChIKey=VRBAFFNLGRKXPC-VHSXEESVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.