* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FMOC-L-NORARG(PMC) |
English Synonyms: | FMOC-L-NORARG(PMC) |
MDL Number.: | MFCD03094778 |
H bond acceptor: | 11 |
H bond donor: | 5 |
Smile: | Cc1c(c(c(c2c1OC(CC2)(C)C)C)S(=O)(=O)NC(=N)NCC[C@@H](C(=O)O)NC(=O)OCC3c4ccccc4-c5c3cccc5)C |
InChi: | InChI=1S/C34H40N4O7S/c1-19-20(2)30(21(3)22-14-16-34(4,5)45-29(19)22)46(42,43)38-32(35)36-17-15-28(31(39)40)37-33(41)44-18-27-25-12-8-6-10-23(25)24-11-7-9-13-26(24)27/h6-13,27-28H,14-18H2,1-5H3,(H,37,41)(H,39,40)(H3,35,36,38)/t28-/m0/s1 |
InChiKey: | InChIKey=HODIEVQUBTVYDO-NDEPHWFRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.