* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FMOC-L-SER(O-ALLYL)-OH |
English Synonyms: | FMOC-L-SER(O-ALLYL)-OH |
MDL Number.: | MFCD03094795 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | C=CCOC[C@@H](C(=O)O)NC(=O)OCC1c2ccccc2-c3c1cccc3 |
InChi: | InChI=1S/C21H21NO5/c1-2-11-26-13-19(20(23)24)22-21(25)27-12-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h2-10,18-19H,1,11-13H2,(H,22,25)(H,23,24)/t19-/m0/s1 |
InChiKey: | InChIKey=BFEBKKIRUYSHKY-IBGZPJMESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.