* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FMOC-L-TIC(7-BR) |
English Synonyms: | FMOC-L-TIC(7-BR) |
MDL Number.: | MFCD03094816 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)-c3ccccc3C2COC(=O)N4Cc5cc(ccc5C[C@H]4C(=O)O)Br |
InChi: | InChI=1S/C25H20BrNO4/c26-17-10-9-15-12-23(24(28)29)27(13-16(15)11-17)25(30)31-14-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-11,22-23H,12-14H2,(H,28,29)/t23-/m0/s1 |
InChiKey: | InChIKey=NLOWLSCJVKJXQX-QHCPKHFHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.