* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FMOC-(2S, 5S)-LYSINE(5-OH, N-ALLOC) |
English Synonyms: | FMOC-(2S, 5S)-LYSINE(5-OH, N-ALLOC) |
MDL Number.: | MFCD03094826 |
H bond acceptor: | 9 |
H bond donor: | 4 |
Smile: | C=CCOC(=O)NC[C@H](CC[C@@H](C(=O)O)NC(=O)OCC1c2ccccc2-c3c1cccc3)O |
InChi: | InChI=1S/C25H28N2O7/c1-2-13-33-24(31)26-14-16(28)11-12-22(23(29)30)27-25(32)34-15-21-19-9-5-3-7-17(19)18-8-4-6-10-20(18)21/h2-10,16,21-22,28H,1,11-15H2,(H,26,31)(H,27,32)(H,29,30)/t16-,22-/m0/s1 |
InChiKey: | InChIKey=TYSCPLAUFDQTOW-AOMKIAJQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.