* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FMOC-(2S, 3S)-GLU(3-ME) |
English Synonyms: | FMOC-(2S, 3S)-GLU(3-ME) |
MDL Number.: | MFCD03094834 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | C[C@@H](CC(=O)O)[C@@H](C(=O)O)NC(=O)OCC1c2ccccc2-c3c1cccc3 |
InChi: | InChI=1S/C21H21NO6/c1-12(10-18(23)24)19(20(25)26)22-21(27)28-11-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-9,12,17,19H,10-11H2,1H3,(H,22,27)(H,23,24)(H,25,26)/t12-,19-/m0/s1 |
InChiKey: | InChIKey=FNYBBLFLPDDSHV-BUXKBTBVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.