* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FURA-2(K+ SALT) |
| English Synonyms: | FURA-2(K+ SALT) |
| MDL Number.: | MFCD03095581 |
| H bond acceptor: | 17 |
| H bond donor: | 4 |
| Smile: | Cc1ccc(c(c1)OCCOc2cc3cc(oc3cc2N(CC(=O)O)CC(=O)O)c4ncc(o4)C(=O)[O-])N(CC(=O)O)CC(=O)O.[K+] |
| InChi: | InChI=1S/C29H27N3O14.K/c1-15-2-3-17(31(11-24(33)34)12-25(35)36)20(6-15)43-4-5-44-21-7-16-8-22(28-30-10-23(46-28)29(41)42)45-19(16)9-18(21)32(13-26(37)38)14-27(39)40;/h2-3,6-10H,4-5,11-14H2,1H3,(H,33,34)(H,35,36)(H,37,38)(H,39,40)(H,41,42);/q;+1/p-1 |
| InChiKey: | InChIKey=FPUSWHNHKOAVCU-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.