* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 27283256 |
| English Synonyms: | EMOLECULES 27283256 |
| MDL Number.: | MFCD03110114 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1ccc2c(c1)nc(s2)/C(=C(/CCl)\O)/C#N |
| InChi: | InChI=1S/C11H7ClN2OS/c12-5-9(15)7(6-13)11-14-8-3-1-2-4-10(8)16-11/h1-4,15H,5H2/b9-7- |
| InChiKey: | InChIKey=MUCKQWWUWPHMCR-CLFYSBASSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.