* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHYL (2E)-5-(3-PYRIDINYL)-2-PENTENOATE |
| English Synonyms: | ETHYL (2E)-5-(3-PYRIDINYL)-2-PENTENOATE |
| MDL Number.: | MFCD03265786 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CCOC(=O)/C=C/CCc1cccnc1 |
| InChi: | InChI=1S/C12H15NO2/c1-2-15-12(14)8-4-3-6-11-7-5-9-13-10-11/h4-5,7-10H,2-3,6H2,1H3/b8-4+ |
| InChiKey: | InChIKey=YTQSEGOSTMKINN-XBXARRHUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.