* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9,10-DIMETHOXY-1,6,7,11B-TETRAHYDRO-2H-PYRIDO[2,1-A]ISOQUINOLINE-2,4(3H)-DIONE |
English Synonyms: | 9,10-DIMETHOXY-1,6,7,11B-TETRAHYDRO-2H-PYRIDO[2,1-A]ISOQUINOLINE-2,4(3H)-DIONE |
MDL Number.: | MFCD03305515 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | COc1cc2c(cc1OC)C3CC(=O)CC(=O)N3CC2 |
InChi: | InChI=1S/C15H17NO4/c1-19-13-5-9-3-4-16-12(6-10(17)7-15(16)18)11(9)8-14(13)20-2/h5,8,12H,3-4,6-7H2,1-2H3 |
InChiKey: | InChIKey=XFQOUAQRCFBYQW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.