* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB036475 |
| English Synonyms: | VITAS-BB TBB036475 |
| MDL Number.: | MFCD03312396 |
| H bond acceptor: | 7 |
| H bond donor: | 0 |
| Smile: | [H]C12CC3([H])CC([H])(C1)CC(C2)(C3)N1C=C(C(C2=CC3=C(OCO3)C=C2)C(=C1)C(=O)OC)C(=O)OC |
| InChi: | InChI=1S/C26H29NO6/c1-30-24(28)19-12-27(26-9-15-5-16(10-26)7-17(6-15)11-26)13-20(25(29)31-2)23(19)18-3-4-21-22(8-18)33-14-32-21/h3-4,8,12-13,15-17,23H,5-7,9-11,14H2,1-2H3 |
| InChiKey: | InChIKey=XGCPMBCVWZTODB-OSZUOCJZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.