* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB036485 |
| English Synonyms: | VITAS-BB TBB036485 |
| MDL Number.: | MFCD03312411 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CCOC(=O)C1=C(NC(=O)C2CC2)SC(C(=O)NC2CCCCC2)=C1C |
| InChi: | InChI=1S/C19H26N2O4S/c1-3-25-19(24)14-11(2)15(17(23)20-13-7-5-4-6-8-13)26-18(14)21-16(22)12-9-10-12/h12-13H,3-10H2,1-2H3,(H,20,23)(H,21,22) |
| InChiKey: | InChIKey=DGOXRGUDNUZGCA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.