* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB022506 |
| English Synonyms: | VITAS-BB TBB022506 |
| MDL Number.: | MFCD03363984 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CCC1CCC2=C(C1)SC(NC(=O)C1=CC=C(C=C1Cl)[N+]([O-])=O)=C2C(N)=O |
| InChi: | InChI=1S/C18H18ClN3O4S/c1-2-9-3-5-12-14(7-9)27-18(15(12)16(20)23)21-17(24)11-6-4-10(22(25)26)8-13(11)19/h4,6,8-9H,2-3,5,7H2,1H3,(H2,20,23)(H,21,24) |
| InChiKey: | InChIKey=JTSOXVRTUZLDFR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.