* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB023149 |
| English Synonyms: | VITAS-BB TBB023149 |
| MDL Number.: | MFCD03374966 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | IC1=CC=CC=C1\C=N\NC(=O)C1=CNC2=C1C=CC=C2 |
| InChi: | InChI=1S/C16H12IN3O/c17-14-7-3-1-5-11(14)9-19-20-16(21)13-10-18-15-8-4-2-6-12(13)15/h1-10,18H,(H,20,21)/b19-9+ |
| InChiKey: | InChIKey=MWSRFZUYZFVMHW-DJKKODMXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.