* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB024276 |
| English Synonyms: | VITAS-BB TBB024276 |
| MDL Number.: | MFCD03375222 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | [O-][N+](=O)C1=CC=CC=C1C(=O)N\N=C1\CC2C=CCC12 |
| InChi: | InChI=1S/C14H13N3O3/c18-14(11-5-1-2-7-13(11)17(19)20)16-15-12-8-9-4-3-6-10(9)12/h1-5,7,9-10H,6,8H2,(H,16,18)/b15-12- |
| InChiKey: | InChIKey=NGJYTQHVQCJDMC-QINSGFPZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.