Molecular Structure:
CCD No.:CCD00375508
BUTTPARK 35\03-83
Formula:C10 H8 F3 N3 O S
MolWeight:275.253
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | BUTTPARK 35\03-83 |
| English Synonyms： | BUTTPARK 35\03-83 |
| MDL Number.： | MFCD03407471 |
| H bond acceptor： | 4 |
| H bond donor： | 0 |
| Smile： | Cn1c(nnc1S)c2ccccc2OC(F)(F)F |
| InChi： | InChI=1S/C10H8F3N3OS/c1-16-8(14-15-9(16)18)6-4-2-3-5-7(6)17-10(11,12)13/h2-5H,1H3,(H,15,18) |
| InChiKey： | InChIKey=JUFZLUGSFVFQBQ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
