* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH1334989 |
English Synonyms: | FCHGROUP FCH1334989 |
MDL Number.: | MFCD03412743 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1c(csc1/C(=N\O)/CC(=O)O)Br |
InChi: | InChI=1S/C7H6BrNO3S/c8-4-1-6(13-3-4)5(9-12)2-7(10)11/h1,3,12H,2H2,(H,10,11)/b9-5- |
InChiKey: | InChIKey=WCCXGWWZXKQNLP-UITAMQMPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.