* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XANTHOSINE HYDRATE |
| CAS: | 5968-90-1 |
| English Synonyms: | XANTHOSINE HYDRATE |
| MDL Number.: | MFCD03414202 |
| H bond acceptor: | 10 |
| H bond donor: | 5 |
| Smile: | c1nc2c(n1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)[nH]c(=O)[nH]c2=O.O |
| InChi: | InChI=1S/C10H12N4O6.H2O/c15-1-3-5(16)6(17)9(20-3)14-2-11-4-7(14)12-10(19)13-8(4)18;/h2-3,5-6,9,15-17H,1H2,(H2,12,13,18,19);1H2/t3-,5-,6-,9-;/m1./s1 |
| InChiKey: | InChIKey=AQQAMLPKPXTPOL-GWTDSMLYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.