* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | N-(1,3-BENZODIOXOL-5-YLMETHYLENE)-5-(4-ME-PH)-4-PH-4H-1,3,4-THIADIAZIN-2-AMINE |
English Synonyms: | N-(1,3-BENZODIOXOL-5-YLMETHYLENE)-5-(4-ME-PH)-4-PH-4H-1,3,4-THIADIAZIN-2-AMINE |
MDL Number.: | MFCD03414918 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | Cc1ccc(cc1)C2=CSC(=NN2c3ccccc3)/N=C/c4ccc5c(c4)OCO5 |
InChi: | InChI=1S/C24H19N3O2S/c1-17-7-10-19(11-8-17)21-15-30-24(26-27(21)20-5-3-2-4-6-20)25-14-18-9-12-22-23(13-18)29-16-28-22/h2-15H,16H2,1H3/b25-14+ |
InChiKey: | InChIKey=OOTJIWXUSFOCRE-AFUMVMLFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.