* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | N-[(2RS,3RS)-2,3,4-TRIHYDROXY-BUTYL]-VAL-LEU-ANILIDE |
English Synonyms: | N-[(2RS,3RS)-2,3,4-TRIHYDROXY-BUTYL]-VAL-LEU-ANILIDE |
MDL Number.: | MFCD03424228 |
H bond acceptor: | 8 |
H bond donor: | 6 |
Smile: | CC(C)C[C@@H](C(=O)Nc1ccccc1)NC(=O)[C@H](C(C)C)NC[C@H]([C@@H](CO)O)O |
InChi: | InChI=1S/C21H35N3O5/c1-13(2)10-16(20(28)23-15-8-6-5-7-9-15)24-21(29)19(14(3)4)22-11-17(26)18(27)12-25/h5-9,13-14,16-19,22,25-27H,10-12H2,1-4H3,(H,23,28)(H,24,29)/t16-,17+,18+,19-/m0/s1 |
InChiKey: | InChIKey=PNQFKGZQIFWWOZ-MANSERQUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.