* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 9,9-BIS(2-ETHYLHEXYL)-2,7-DIIODO-9H-FLUORENE |
CAS: | 278176-08-2 |
English Synonyms: | 9,9-BIS(2-ETHYLHEXYL)-2,7-DIIODO-9H-FLUORENE |
MDL Number.: | MFCD03427151 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CCCCC(CC)CC1(c2cc(ccc2-c3c1cc(cc3)I)I)CC(CC)CCCC |
InChi: | InChI=1S/C29H40I2/c1-5-9-11-21(7-3)19-29(20-22(8-4)12-10-6-2)27-17-23(30)13-15-25(27)26-16-14-24(31)18-28(26)29/h13-18,21-22H,5-12,19-20H2,1-4H3 |
InChiKey: | InChIKey=BKFQJJIOFQOZEO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.