* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH095912 |
English Synonyms: | FCHGROUP FCH095912 |
MDL Number.: | MFCD03493220 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC1=C(Cl)C=C(NC(=S)N2CCCCC2)C=C1 |
InChi: | InChI=1S/C13H17ClN2S/c1-10-5-6-11(9-12(10)14)15-13(17)16-7-3-2-4-8-16/h5-6,9H,2-4,7-8H2,1H3,(H,15,17) |
InChiKey: | InChIKey=FKHNNILHTWLKBX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.