* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | N-ALLYL-N'-(1H-INDAZOL-4-YL)THIOUREA |
English Synonyms: | N-ALLYL-N'-(1H-INDAZOL-4-YL)THIOUREA |
MDL Number.: | MFCD03617602 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | C=CCNC(=S)Nc1cccc2c1cn[nH]2 |
InChi: | InChI=1S/C11H12N4S/c1-2-6-12-11(16)14-9-4-3-5-10-8(9)7-13-15-10/h2-5,7H,1,6H2,(H,13,15)(H2,12,14,16) |
InChiKey: | InChIKey=LNHCUHXUEFPOPO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.