Molecular Structure:
CCD No.:CCD00400151
BUTTPARK 135\41-71
Formula:C21 H23 N5 O2 S2
MolWeight:441.578
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | BUTTPARK 135\41-71 |
| English Synonyms： | BUTTPARK 135\41-71 |
| MDL Number.： | MFCD03644130 |
| H bond acceptor： | 7 |
| H bond donor： | 2 |
| Smile： | c1ccc(cc1)NC(=O)NC(=O)CSc2nnc(n2C3CCCCC3)c4cccs4 |
| InChi： | InChI=1S/C21H23N5O2S2/c27-18(23-20(28)22-15-8-3-1-4-9-15)14-30-21-25-24-19(17-12-7-13-29-17)26(21)16-10-5-2-6-11-16/h1,3-4,7-9,12-13,16H,2,5-6,10-11,14H2,(H2,22,23,27,28) |
| InChiKey： | InChIKey=AXMSQLSYJJXFOV-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
