Molecular Structure:
CCD No.:CCD00400167
BUTTPARK 134\40-82
Formula:C24 H16 Cl N O3
MolWeight:401.847
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | BUTTPARK 134\40-82 |
| English Synonyms： | BUTTPARK 134\40-82 |
| MDL Number.： | MFCD03644213 |
| H bond acceptor： | 4 |
| H bond donor： | 0 |
| Smile： | c1ccc(cc1)c2c(c3cccc4c3n(c2=O)CC4)OC(=O)c5ccc(cc5)Cl |
| InChi： | InChI=1S/C24H16ClNO3/c25-18-11-9-17(10-12-18)24(28)29-22-19-8-4-7-16-13-14-26(21(16)19)23(27)20(22)15-5-2-1-3-6-15/h1-12H,13-14H2 |
| InChiKey： | InChIKey=GDWDRDMFADNWJR-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
