Molecular Structure:
CCD No.:CCD00400172
BUTTPARK 134\40-49
Formula:C19 H13 N5 O3 S
MolWeight:391.41
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | BUTTPARK 134\40-49 |
| English Synonyms： | BUTTPARK 134\40-49 |
| MDL Number.： | MFCD03644218 |
| H bond acceptor： | 8 |
| H bond donor： | 0 |
| Smile： | CCOC(=O)c1c2nc(c3ccccc3n2nn1)Sc4nc5ccccc5o4 |
| InChi： | InChI=1S/C19H13N5O3S/c1-2-26-18(25)15-16-21-17(11-7-3-5-9-13(11)24(16)23-22-15)28-19-20-12-8-4-6-10-14(12)27-19/h3-10H,2H2,1H3 |
| InChiKey： | InChIKey=YNTYYNZCCBUMHB-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
