Molecular Structure:
CCD No.:CCD00404635
BUTTPARK 64\41-20
Formula:C18 H15 F3 N4 O2 S
MolWeight:408.402
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | BUTTPARK 64\41-20 |
| English Synonyms： | BUTTPARK 64\41-20 |
| MDL Number.： | MFCD03658388 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | Cn1c(nnc1SCC(=O)Nc2ccc(cc2)OC(F)(F)F)c3ccccc3 |
| InChi： | InChI=1S/C18H15F3N4O2S/c1-25-16(12-5-3-2-4-6-12)23-24-17(25)28-11-15(26)22-13-7-9-14(10-8-13)27-18(19,20)21/h2-10H,11H2,1H3,(H,22,26) |
| InChiKey： | InChIKey=GONFIRPZDAXHOG-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
