* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | YO-PRO 3 |
CAS: | 157199-62-7 |
English Synonyms: | YO-PRO 3 |
MDL Number.: | MFCD03788222 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CN\1c2ccccc2O/C1=C/C=C/c3cc[n+](c4c3cccc4)CCC[N+](C)(C)C.[I-].[I-] |
InChi: | InChI=1S/C26H31N3O.2HI/c1-27-24-14-7-8-15-25(24)30-26(27)16-9-11-21-17-19-28(18-10-20-29(2,3)4)23-13-6-5-12-22(21)23;;/h5-9,11-17,19H,10,18,20H2,1-4H3;2*1H/q+2;;/p-2 |
InChiKey: | InChIKey=ZVUUXEGAYWQURQ-UHFFFAOYSA-L |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.