* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WITHANOLIDE D |
CAS: | 30655-48-2 |
English Synonyms: | WITHANOLIDE D |
MDL Number.: | MFCD03788769 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CC1=C(C(=O)O[C@H](C1)[C@@](C)([C@H]2CC[C@@H]3[C@@]2(CC[C@H]4[C@H]3C[C@@H]5[C@]6([C@@]4(C(=O)C=C[C@@H]6O)C)O5)C)O)C |
InChi: | InChI=1S/C28H38O6/c1-14-12-22(33-24(31)15(14)2)27(5,32)19-7-6-17-16-13-23-28(34-23)21(30)9-8-20(29)26(28,4)18(16)10-11-25(17,19)3/h8-9,16-19,21-23,30,32H,6-7,10-13H2,1-5H3/t16-,17-,18-,19-,21-,22+,23+,25-,26-,27+,28+/m0/s1 |
InChiKey: | InChIKey=SASUFNRGCZMRFD-JCUIILOWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.