Molecular Structure:
CCD No.:CCD00418331
GR 218231
CAS No.:
175442-95-2
Formula:C24 H33 N O3 S
MolWeight:415.595
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | GR 218231 |
| CAS： | 175442-95-2 |
| English Synonyms： | GR 218231 |
| MDL Number.： | MFCD03792691 |
| H bond acceptor： | 4 |
| H bond donor： | 0 |
| Smile： | CCCN(CCC)C1CCc2cc(ccc2C1)CS(=O)(=O)c3ccc(cc3)OC |
| InChi： | InChI=1S/C24H33NO3S/c1-4-14-25(15-5-2)22-9-8-20-16-19(6-7-21(20)17-22)18-29(26,27)24-12-10-23(28-3)11-13-24/h6-7,10-13,16,22H,4-5,8-9,14-15,17-18H2,1-3H3 |
| InChiKey： | InChIKey=HUXFXXWYIRBVJR-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
