* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL034121 |
English Synonyms: | SYNTHON-LAB SL034121 |
MDL Number.: | MFCD03834681 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | COc1cc(cc(c1OCC#N)I)/C=C/2\C(=O)N(/C(=N/Cc3ccccc3)/S2)Cc4ccccc4 |
InChi: | InChI=1S/C27H22IN3O3S/c1-33-23-15-21(14-22(28)25(23)34-13-12-29)16-24-26(32)31(18-20-10-6-3-7-11-20)27(35-24)30-17-19-8-4-2-5-9-19/h2-11,14-16H,13,17-18H2,1H3/b24-16+,30-27- |
InChiKey: | InChIKey=ZCGLPCQZBGPJMT-RZWNPCLDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.