* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL031936 |
| English Synonyms: | SYNTHON-LAB SL031936 |
| MDL Number.: | MFCD03834683 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | Cc1cccc(c1)N2C(=O)/C(=C\c3ccc(o3)c4ccc(c(c4)C(=O)O)Cl)/C(=O)NC2=O |
| InChi: | InChI=1S/C23H15ClN2O6/c1-12-3-2-4-14(9-12)26-21(28)17(20(27)25-23(26)31)11-15-6-8-19(32-15)13-5-7-18(24)16(10-13)22(29)30/h2-11H,1H3,(H,29,30)(H,25,27,31)/b17-11- |
| InChiKey: | InChIKey=HFQYIZDCGOBWJF-BOPFTXTBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.