* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL030984 |
English Synonyms: | SYNTHON-LAB SL030984 |
MDL Number.: | MFCD03834691 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CN(C)c1cccc(c1)C(=O)N/N=C/c2ccc(c(c2)OC)OCc3ccc(cc3)I |
InChi: | InChI=1S/C24H24IN3O3/c1-28(2)21-6-4-5-19(14-21)24(29)27-26-15-18-9-12-22(23(13-18)30-3)31-16-17-7-10-20(25)11-8-17/h4-15H,16H2,1-3H3,(H,27,29)/b26-15+ |
InChiKey: | InChIKey=MSPOIKPKYYXMTI-CVKSISIWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.