* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL025191 |
| English Synonyms: | SYNTHON-LAB SL025191 |
| MDL Number.: | MFCD03834705 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | C#CCOc1ccc(cc1Br)/C=C(\C#N)/C(=O)N2CCN(CC2)c3ccccc3 |
| InChi: | InChI=1S/C23H20BrN3O2/c1-2-14-29-22-9-8-18(16-21(22)24)15-19(17-25)23(28)27-12-10-26(11-13-27)20-6-4-3-5-7-20/h1,3-9,15-16H,10-14H2/b19-15+ |
| InChiKey: | InChIKey=LNSHYQJVMWQMBI-XDJHFCHBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.