* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL033988 |
| English Synonyms: | SYNTHON-LAB SL033988 |
| MDL Number.: | MFCD03834718 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCOc1ccc(cc1)/N=C\2/NC(=O)/C(=C\c3cc(n(c3C)c4ccc(cc4)C(C)(C)C)C)/S2 |
| InChi: | InChI=1S/C28H31N3O2S/c1-7-33-24-14-10-22(11-15-24)29-27-30-26(32)25(34-27)17-20-16-18(2)31(19(20)3)23-12-8-21(9-13-23)28(4,5)6/h8-17H,7H2,1-6H3,(H,29,30,32)/b25-17+ |
| InChiKey: | InChIKey=NSCWQWCRAJBYJI-KOEQRZSOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.