* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL033905 |
English Synonyms: | SYNTHON-LAB SL033905 |
MDL Number.: | MFCD03834729 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)c(cn2Cc3ccc(cc3)F)/C=C/4\C(=O)N/C(=N/c5cccc(c5Cl)Cl)/S4 |
InChi: | InChI=1S/C25H16Cl2FN3OS/c26-19-5-3-6-20(23(19)27)29-25-30-24(32)22(33-25)12-16-14-31(21-7-2-1-4-18(16)21)13-15-8-10-17(28)11-9-15/h1-12,14H,13H2,(H,29,30,32)/b22-12+ |
InChiKey: | InChIKey=VUTPWWPGTNUPIB-WSDLNYQXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.