* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL035257 |
| English Synonyms: | SYNTHON-LAB SL035257 |
| MDL Number.: | MFCD03834746 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CCOc1cc(cc(c1O)CC=C)/C=C(\C#N)/C(=O)Nc2cccc(c2)Cl |
| InChi: | InChI=1S/C21H19ClN2O3/c1-3-6-15-9-14(11-19(20(15)25)27-4-2)10-16(13-23)21(26)24-18-8-5-7-17(22)12-18/h3,5,7-12,25H,1,4,6H2,2H3,(H,24,26)/b16-10+ |
| InChiKey: | InChIKey=RVVGRDXCIGMXND-MHWRWJLKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.