* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL031875 |
English Synonyms: | SYNTHON-LAB SL031875 |
MDL Number.: | MFCD03834777 |
H bond acceptor: | 9 |
H bond donor: | 1 |
Smile: | Cc1cc(c(n1c2cc(ccc2OC)Cl)C)/C=C\3/C(=O)NC(=O)N(C3=O)c4ccc5c(c4)OCO5 |
InChi: | InChI=1S/C25H20ClN3O6/c1-13-8-15(14(2)28(13)19-10-16(26)4-6-20(19)33-3)9-18-23(30)27-25(32)29(24(18)31)17-5-7-21-22(11-17)35-12-34-21/h4-11H,12H2,1-3H3,(H,27,30,32)/b18-9- |
InChiKey: | InChIKey=KIPNZLGYCAJEDU-NVMNQCDNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.