* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL033845 |
English Synonyms: | SYNTHON-LAB SL033845 |
MDL Number.: | MFCD03834779 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | Cc1cc(c(n1c2ccc(cc2)OCc3ccc(cc3)Cl)C)/C=C/4\C(=O)N/C(=N/c5ccc(cc5)F)/S4 |
InChi: | InChI=1S/C29H23ClFN3O2S/c1-18-15-21(16-27-28(35)33-29(37-27)32-24-9-7-23(31)8-10-24)19(2)34(18)25-11-13-26(14-12-25)36-17-20-3-5-22(30)6-4-20/h3-16H,17H2,1-2H3,(H,32,33,35)/b27-16+ |
InChiKey: | InChIKey=WFUZTTHATKYGSI-JVWAILMASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.