* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL027017 |
English Synonyms: | SYNTHON-LAB SL027017 |
MDL Number.: | MFCD03834781 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | COc1cc(c(c(c1O)Br)Br)/C=N\NC(=O)CC#N |
InChi: | InChI=1S/C11H9Br2N3O3/c1-19-7-4-6(9(12)10(13)11(7)18)5-15-16-8(17)2-3-14/h4-5,18H,2H2,1H3,(H,16,17)/b15-5- |
InChiKey: | InChIKey=KRFIIASBDRUHOZ-WCSRMQSCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.