* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL027013 |
English Synonyms: | SYNTHON-LAB SL027013 |
MDL Number.: | MFCD03834784 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | c1cc(ccc1COc2ccc(cc2/C=N\NC(=O)CC#N)Br)C(=O)O |
InChi: | InChI=1S/C18H14BrN3O4/c19-15-5-6-16(14(9-15)10-21-22-17(23)7-8-20)26-11-12-1-3-13(4-2-12)18(24)25/h1-6,9-10H,7,11H2,(H,22,23)(H,24,25)/b21-10- |
InChiKey: | InChIKey=LCFCUZDAMUFLLA-FBHDLOMBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.