* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL026978 |
English Synonyms: | SYNTHON-LAB SL026978 |
MDL Number.: | MFCD03834787 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)c(cn2Cc3ccc(cc3)[N+](=O)[O-])/C=N\NC(=O)c4cccs4 |
InChi: | InChI=1S/C21H16N4O3S/c26-21(20-6-3-11-29-20)23-22-12-16-14-24(19-5-2-1-4-18(16)19)13-15-7-9-17(10-8-15)25(27)28/h1-12,14H,13H2,(H,23,26)/b22-12- |
InChiKey: | InChIKey=QGRFORSCKWYLEI-UUYOSTAYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.