* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL035963 |
English Synonyms: | SYNTHON-LAB SL035963 |
MDL Number.: | MFCD03834792 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | Cc1c(c(nc2c1/C(=C\c3ccc(c(c3)Cl)OCC(=O)O)/C(=C2C#N)C)N)C#N |
InChi: | InChI=1S/C21H15ClN4O3/c1-10-13(5-12-3-4-17(16(22)6-12)29-9-18(27)28)19-11(2)15(8-24)21(25)26-20(19)14(10)7-23/h3-6H,9H2,1-2H3,(H2,25,26)(H,27,28)/b13-5- |
InChiKey: | InChIKey=LPANKCMNOHEJLB-ACAGNQJTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.