* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL035568 |
English Synonyms: | SYNTHON-LAB SL035568 |
MDL Number.: | MFCD03834802 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCc1ccc(cc1)/C=C(\C#N)/C(=O)Nc2ccc(cc2)C |
InChi: | InChI=1S/C19H18N2O/c1-3-15-6-8-16(9-7-15)12-17(13-20)19(22)21-18-10-4-14(2)5-11-18/h4-12H,3H2,1-2H3,(H,21,22)/b17-12+ |
InChiKey: | InChIKey=USYGSLZGEOYFGB-SFQUDFHCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.